A7683158
Oxyclozanide , 10mMinDMSO , 2277-92-1
Synonym(s):
2,3,5-Trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide;3,3′,5,5′,6-Pentachloro-2′-hydroxysalicylanilide
CAS NO.:2277-92-1
Empirical Formula: C13H6Cl5NO3
Molecular Weight: 401.46
MDL number: MFCD00864507
EINECS: 218-904-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 77-81C |
| Boiling point: | 215C |
| Density | 1.6274 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 5.07±0.50(Predicted) |
| form | Solid |
| color | White to off-white |
| Water Solubility | 29mg/L(25 ºC) |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C13H6Cl5NO3/c14-4-1-6(16)11(20)8(2-4)19-13(22)9-10(18)5(15)3-7(17)12(9)21/h1-3,20-21H,(H,19,22) |
| InChIKey | JYWIYHUXVMAGLG-UHFFFAOYSA-N |
| SMILES | C(NC1=CC(Cl)=CC(Cl)=C1O)(=O)C1=C(O)C(Cl)=CC(Cl)=C1Cl |
| CAS DataBase Reference | 2277-92-1(CAS DataBase Reference) |
Description and Uses
Anthelmintic
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H410 |
| Precautionary statements | P264-P270-P273-P301+P312-P391-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn;N,N,Xn,Xi |
| Risk Statements | 22-50/53-36/37/38 |
| Safety Statements | 60-61-36-26 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| RTECS | CV8576000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





