A7685712
N,N,N′,N′-Tetramethyl-p-phenylenediamine dihydrochloride(TMPD) , 98% , 637-01-4
Synonym(s):
N,N,N′,N′-Tetramethyl-1,4-phenylenediammonium dichloride;TMPPD;Wurster’s reagent;Wurster-reagent, N,N,N′,N′-Tetramethyl-1,4-phenylene-diamine dihydrochloride
CAS NO.:637-01-4
Empirical Formula: C10H18Cl2N2
Molecular Weight: 237.17
MDL number: MFCD00012482
EINECS: 211-274-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.00 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 25G | RMB516.80 | In Stock |
|
| 100G | RMB1766.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222-224 °C(lit.) |
| Boiling point: | 378.54°C (rough estimate) |
| Density | 1.1961 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | room temp |
| solubility | H2O: soluble500mg/10 mL |
| form | powder |
| color | off-white to gray |
| Water Solubility | SOLUBLE |
| Sensitive | Light Sensitive |
| BRN | 5132096 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C10H16N2.ClH/c1-11(2)9-5-7-10(8-6-9)12(3)4;/h5-8H,1-4H3;1H |
| InChIKey | DNRUPOAHVJBDJE-UHFFFAOYSA-N |
| SMILES | N(C1C=CC(N(C)C)=CC=1)(C)C.Cl |
| CAS DataBase Reference | 637-01-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Benzenediamine, N,N,N',N'-tetramethyl-, dihydrochloride (637-01-4) |
Description and Uses
N,N,N′,N′-Tetramethyl-p-phenylenediamine dihydrochloride has been used to determine the oxidase activity displayed by various microorganisms.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22-40 |
| Safety Statements | 26-36-36/37-22-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29215190 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |



![2,3,4,5-Tetrahydro-1H-benzo[e][1,4]diazepinedihydrochloride](https://img.chemicalbook.com/CAS/GIF/5177-43-5.gif)


