1,3,5-Triisopropylbenzene , 95% , 717-74-8
CAS NO.:717-74-8
Empirical Formula: C15H24
Molecular Weight: 204.35
MDL number: MFCD00008890
EINECS: 211-941-3
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB36.80 | In Stock |
|
| 25ML | RMB67.20 | In Stock |
|
| 50ML | RMB79.20 | In Stock |
|
| 100ML | RMB216.00 | In Stock |
|
| 500ML | RMB834.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | -14--11°C |
| Boiling point: | 232-236 °C (lit.) |
| Density | 0.845 g/mL at 25 °C (lit.) |
| vapor pressure | 0.91Pa at 25℃ |
| refractive index | n |
| Flash point: | 188 °F |
| storage temp. | Store below +30°C. |
| form | Liquid |
| Specific Gravity | 0.845 |
| color | Clear colorless |
| Water Solubility | Immiscible with water. |
| BRN | 1862750 |
| InChI | 1S/C15H24/c1-10(2)13-7-14(11(3)4)9-15(8-13)12(5)6/h7-12H,1-6H3 |
| InChIKey | VUMCUSHVMYIRMB-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(cc(c1)C(C)C)C(C)C |
| LogP | 6.68 at 24℃ |
| CAS DataBase Reference | 717-74-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,3,5-tris(1-methylethyl)-(717-74-8) |
| EPA Substance Registry System | 1,3,5-Triisopropylbenzene (717-74-8) |
Description and Uses
1,3,5-Triisopropylbenzene is a versatile compound that has several applications in various industries. It is commonly used as a fuel and fuel additive, as well as in lubricants and lubricant additives. Additionally, it is utilized in the production of 2,4,6-triisopropyl-benzenesulfonyl chloride. This compound is also effective as a swelling agent in the synthesis of mesoporous silica with hexagonal pores. Furthermore, it serves as a micelle expander in the creation of magnetic mesoporous silica nanoparticles.
1,3,5-Triisopropylbenzene can be usually used as swelling agent during the synthesis of mesoporous silicas with two-dimensional hexagonal pores,also used as micelle expander in the synthesis of highly ordered mesoporous SBA-15 silica and magnetic mesoporous silica nanoparticles.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 23-24/25 |
| RIDADR | NA1993 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | CBL |
| HS Code | 29029080 |
| Storage Class | 10 - Combustible liquids |
| Excepted Quantities | Non-Hazardous |





