Trioctylphosphine , 90% , 4731-53-7
Synonym(s):
P(Oct)3;TOP
CAS NO.：4731-53-7
Empirical Formula: C24H51P
Molecular Weight: 370.64
MDL number: MFCD00015298
EINECS: 225-234-2
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB37.60 | In Stock |
|
| 25ML | RMB112.80 | In Stock |
|
| 100ML | RMB417.60 | In Stock |
|
| 500ML | RMB1938.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 30°C |
| Boiling point: | 284-291 °C50 mm Hg(lit.) |
| Density | 0.831 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 297 °F |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | Powder or Crystalline Powder |
| color | White to off-white |
| Specific Gravity | 0.831 |
| Water Solubility | Immiscible with water. |
| Sensitive | Air Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 1776995 |
| InChI | InChI=1S/C24H51P/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3 |
| InChIKey | RMZAYIKUYWXQPB-UHFFFAOYSA-N |
| SMILES | P(CCCCCCCC)(CCCCCCCC)CCCCCCCC |
| CAS DataBase Reference | 4731-53-7(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphine, trioctyl- (4731-53-7) |
Description and Uses
Trioctylphosphine (also known as Tri-n-octylphosphine, abbreviated as TOP) is a weakly basic organophosphorus compound that can be used in the synthesis of nanomaterials (such as metallic nanoparticles). It also serves as the most popular organophosphorus source in oil-phase synthesis, a stabiliser for certain nanorods, and acts as a solvent in certain chemical processes.
Tri-n-octylphosphine is used for coating zinc sulfide shells on cadmium-selenium quantum dot core by successive ionic layer adsorption and reaction method. It acts as a precursor to trioctylphosphine oxide. Further, it is used as a solvent for cadmium and selenium precursors. It also serves as a common reagent in the chemical synthesis of nanoparticles. It acts as a precursor to trioctylphosphine oxide.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-36/37/39-45-37/39 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 2 |
| RTECS | SZ3450000 |
| F | 10-13-23 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29310099 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
