A7689612
3-(Trifluoromethyl)phenylacetic acid , 98% , 351-35-9
Synonym(s):
(α,α,α-Trifluoro-m-tolyl)acetic acid
CAS NO.：351-35-9
Empirical Formula: C9H7F3O2
Molecular Weight: 204.15
MDL number: MFCD00004339
EINECS: 206-511-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB48.00 | In Stock |
|
| 25G | RMB186.40 | In Stock |
|
| 100G | RMB669.60 | In Stock |
|
| 500g | RMB2073.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-79 °C(lit.) |
| Boiling point: | 238C/775Torr |
| Density | 1.357±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 4.14±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2213223 |
| InChI | InChI=1S/C9H7F3O2/c10-9(11,12)7-3-1-2-6(4-7)5-8(13)14/h1-4H,5H2,(H,13,14) |
| InChIKey | BLXXCCIBGGBDHI-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 351-35-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzeneacetic acid, 3-(trifluoromethyl)- (351-35-9) |
Description and Uses
m-(Trifluoromethyl)phenylacetic acid is used as a reactant in a mechanistic study on ligand-accelerated C-H activation reactions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
