PRODUCT Properties
| Melting point: | 125-128 °C |
| Boiling point: | 343.2±15.0 °C(Predicted) |
| Density | 1.327±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly, Heated), Methanol (Slightly) |
| form | Shiny Crystalline Powder |
| pka | 10.07±0.40(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C8H7NO/c10-7-2-1-6-3-4-9-8(6)5-7/h1-5,9-10H |
| InChIKey | XAWPKHNOFIWWNZ-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(O)=C2)C=C1 |
| CAS DataBase Reference | 2380-86-1(CAS DataBase Reference) |
Description and Uses
- Reactant for preparation of tryptophan dioxygenase inhibitors pyridyl-ethenyl-indoles as potential anticancer immunomodulators
- Reactant for asymmetrical synthesis of notoamide J as a potential biosynthetic precursor of prenylated indole alkaloids
- Reactant for preparation of (quinolinyloxymethyl)isoxazolecarboxylate esters antituberculosis agents
- Reactant for preparation of indolyl(propanolamine) derivatives as HIV inhibitors
- Reactant for preparation of indoleoxyacetic acid derivatives as peroxisome proliferator-activated receptor agonists
- Reactant for preparation of 1-aroylindole 3-aroylindoles combretastatin A-4 analogs as antitumor agents and tubulin polymerization inhibitors
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H317-H318-H411 |
| Precautionary statements | P273-P280-P305+P351+P338 |
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-51/53-43-41-22 |
| Safety Statements | 37/39-26-61-24-2 |
| RIDADR | UN 3077 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, KEEP COLD |
| HazardClass | 9 |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |









