A7691012
2,3,5-Triiodobenzoic acid , 98% , 88-82-4
Synonym(s):
TIBA
CAS NO.:88-82-4
Empirical Formula: C7H3I3O2
Molecular Weight: 499.81
MDL number: MFCD00002420
EINECS: 201-859-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB80.00 | In Stock |
|
| 10g | RMB137.60 | In Stock |
|
| 25G | RMB271.20 | In Stock |
|
| 100G | RMB862.40 | In Stock |
|
| 500g | RMB3599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-222 °C (lit.) |
| Boiling point: | 456.7±45.0 °C(Predicted) |
| Density | 2.7985 (estimate) |
| storage temp. | -20°C |
| solubility | methanol: soluble5%, hazy, orange to very deep orange (light) |
| form | Solid |
| pka | 2.16±0.10(Predicted) |
| color | Light brown |
| Water Solubility | Insoluble in water. |
| Sensitive | Light Sensitive |
| BRN | 1955088 |
| InChI | InChI=1S/C7H3I3O2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12) |
| InChIKey | ZMZGFLUUZLELNE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(I)=CC(I)=C1I |
| CAS DataBase Reference | 88-82-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3,5-Triiodobenzoic acid(88-82-4) |
| EPA Substance Registry System | 2,3,5-Triiodobenzoic acid (88-82-4) |
Description and Uses
2,3,5-Triiodobenzoic Acid is a polar auxin transport inhibitor that inhibits and promotes endoreduplication in hypocotyls and cotyledons.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-26-36-24/25 |
| WGK Germany | 3 |
| RTECS | DH9275000 |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 88-82-4(Hazardous Substances Data) |





