A7692512
Tetraoctylammonium bromide , 98% , 14866-33-2
Synonym(s):
Tetra-n-octylammonium bromide;TOAB
CAS NO.:14866-33-2
Empirical Formula: C32H68BrN
Molecular Weight: 546.79
MDL number: MFCD00011863
EINECS: 238-936-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 10g | RMB26.56 | In Stock |
|
| 25G | RMB38.40 | In Stock |
|
| 50g | RMB63.20 | In Stock |
|
| 100G | RMB109.60 | In Stock |
|
| 250g | RMB247.20 | In Stock |
|
| 500G | RMB455.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-98 °C(lit.) |
| Boiling point: | 209.3℃[at 101 325 Pa] |
| Density | 1.0041 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5260 (estimate) |
| Flash point: | 100°C |
| storage temp. | Store below +30°C. |
| solubility | 600g/l |
| form | Powder or Flakes |
| color | White to creamy-white |
| PH | 7 (100g/l, H2O, 20℃) |
| Water Solubility | soluble |
| λmax | λ: 240 nm Amax: 0.04 λ: 250 nm Amax: 0.03 λ: 260 nm Amax: 0.02 λ: 500 nm Amax: 0.02 |
| Sensitive | Hygroscopic |
| BRN | 4169176 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C32H68N.BrH/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;/h5-32H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | QBVXKDJEZKEASM-UHFFFAOYSA-M |
| SMILES | [Br-].CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC |
| LogP | 4.47 at 25℃ |
| CAS DataBase Reference | 14866-33-2(CAS DataBase Reference) |
Description and Uses
TOAB has been used as recognition element in formulating potentiometric membrane to develop an electronic tongue system for monitoring nitrogen species level in water samples.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 |




