A7696012
Trimethylsulfonium iodide , 98% , 2181-42-2
CAS NO.：2181-42-2
Empirical Formula: C3H9IS
Molecular Weight: 204.07
MDL number: MFCD00011632
EINECS: 218-555-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB80.00 | In Stock |
|
| 50g | RMB159.20 | In Stock |
|
| 100G | RMB286.40 | In Stock |
|
| 250g | RMB631.20 | In Stock |
|
| 500G | RMB1140.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215-220 °C (lit.) |
| Density | 1.6554 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in water, alcohol, THF, DMSO |
| form | Crystalline Powder, Crystals and/or Chunks |
| color | White to yellow |
| Water Solubility | soluble |
| Sensitive | Light Sensitive |
| BRN | 3555192 |
| Exposure limits | ACGIH: TWA 0.01 ppm |
| InChI | InChI=1S/C3H9S.HI/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 |
| InChIKey | VFJYIHQDILEQNR-UHFFFAOYSA-M |
| SMILES | [S+](C)(C)C.[I-] |
| CAS DataBase Reference | 2181-42-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Trimethylsulfonium iodide(2181-42-2) |
| EPA Substance Registry System | Trimethylsulfonium iodide (2181-42-2) |
Description and Uses
Trimethylsulfonium iodide is a salt that is usually dissolved in strong base in order to synthesize epoxides in-situ. Trimethylsulfonium iodide also has the potential to inhibit human placental diamine oxidase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | WR8750000 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29309070 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
