A7696012
                    Trimethylsulfonium iodide , 98% , 2181-42-2
CAS NO.:2181-42-2
Empirical Formula: C3H9IS
Molecular Weight: 204.07
MDL number: MFCD00011632
EINECS: 218-555-4
| Pack Size | Price | Stock | Quantity | 
| 5G | RMB23.20 | In Stock | 
                                                 | 
                                        
| 25G | RMB80.00 | In Stock | 
                                                 | 
                                        
| 50g | RMB159.20 | In Stock | 
                                                 | 
                                        
| 100G | RMB286.40 | In Stock | 
                                                 | 
                                        
| 250g | RMB631.20 | In Stock | 
                                                 | 
                                        
| 500G | RMB1140.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 215-220 °C (lit.) | 
                                    
| Density | 1.6554 (estimate) | 
                                    
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature | 
                                    
| solubility | Soluble in water, alcohol, THF, DMSO | 
                                    
| form | Crystalline Powder, Crystals and/or Chunks | 
                                    
| color | White to yellow | 
                                    
| Water Solubility | soluble | 
                                    
| Sensitive | Light Sensitive | 
                                    
| BRN | 3555192 | 
                                    
| Exposure limits | ACGIH: TWA 0.01 ppm | 
                                    
| InChI | InChI=1S/C3H9S.HI/c1-4(2)3;/h1-3H3;1H/q+1;/p-1 | 
                                    
| InChIKey | VFJYIHQDILEQNR-UHFFFAOYSA-M | 
                                    
| SMILES | [S+](C)(C)C.[I-] | 
                                    
| CAS DataBase Reference | 2181-42-2(CAS DataBase Reference) | 
                                    
| NIST Chemistry Reference | Trimethylsulfonium iodide(2181-42-2) | 
                                    
| EPA Substance Registry System | Trimethylsulfonium iodide (2181-42-2) | 
                                    
Description and Uses
Trimethylsulfonium iodide is a salt that is usually dissolved in strong base in order to synthesize epoxides in-situ. Trimethylsulfonium iodide also has the potential to inhibit human placental diamine oxidase.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36 | 
| WGK Germany | 3 | 
| RTECS | WR8750000 | 
| F | 8 | 
| TSCA | Yes | 
| HazardClass | IRRITANT | 
| HS Code | 29309070 | 






