A7696612
Triethoxy(octyl)silane , 97% , 2943-75-1
Synonym(s):
n-Octyltriethoxysilane;Octyltriethoxysilane;Triethoxyoctylsilane
CAS NO.:2943-75-1
Empirical Formula: C14H32O3Si
Molecular Weight: 276.49
MDL number: MFCD00039883
EINECS: 220-941-2
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB23.20 | In Stock |
|
| 50ML | RMB31.20 | In Stock |
|
| 100ML | RMB48.80 | In Stock |
|
| 250ML | RMB79.20 | In Stock |
|
| 500ML | RMB136.00 | In Stock |
|
| 2.5L | RMB546.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-40°C |
| Boiling point: | 84-85 °C0.5 mm Hg(lit.) |
| Density | 0.88 g/mL at 25 °C(lit.) |
| vapor pressure | 0.1 hPa (20 °C) |
| refractive index | n |
| Flash point: | 210 °F |
| storage temp. | Store below +30°C. |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | liquid |
| Specific Gravity | 0.875 |
| color | Colorless to Almost colorless |
| Odor | Mild odor |
| Water Solubility | reacts |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 2325287 |
| Cosmetics Ingredients Functions | BINDING |
| InChI | 1S/C14H32O3Si/c1-5-9-10-11-12-13-14-18(15-6-2,16-7-3)17-8-4/h5-14H2,1-4H3 |
| InChIKey | MSRJTTSHWYDFIU-UHFFFAOYSA-N |
| SMILES | CCCCCCCC[Si](OCC)(OCC)OCC |
| LogP | -0.3-6.41 at 20℃ |
| CAS DataBase Reference | 2943-75-1(CAS DataBase Reference) |
| NIST Chemistry Reference | N-Octyltriethoxysilane(2943-75-1) |
| EPA Substance Registry System | Triethoxyoctylsilane (2943-75-1) |
Description and Uses
Triethoxy(octyl)silane is a hydrophobization agent used to limit coalescence in solid-stabilized emulsions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 1 |
| RTECS | VV6695500 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29310095 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Skin Irrit. 2 |
| Toxicity | LD50 orally in Rabbit: 5110 mg/kg LD50 dermal Rabbit 5142 mg/kg |







