PRODUCT Properties
| Melting point: | 65-69 °C (lit.) |
| Boiling point: | 306 °C |
| Density | 1.1708 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform and Ethyl Acetate. |
| pka | 4.19±0.10(Predicted) |
| form | Flakes |
| color | White to slightly yellow |
| Water Solubility | SLIGHTLY SOLUBLE |
| BRN | 2614004 |
| InChI | InChI=1S/C9H10O3/c1-12-8-4-2-3-7(5-8)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | LEGPZHPSIPPYIO-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(OC)=C1 |
| LogP | 1.500 |
| CAS DataBase Reference | 1798-09-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetic acid, 3-methoxy-(1798-09-0) |
Description and Uses
A fluorimetric method for the estimation of 4-hydroxy-3-methoxyphenylacetic acid (homovanillic acid) has been developed and applied to normal brain tissue. The presence of homovanillic acid in the caudate nucleus of normal animals of several species has been demonstrated.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | AI8940000 |
| HazardClass | IRRITANT |
| HS Code | 29189090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |
