A7697712
3,4,5-Trimethoxyaniline , 97% , 24313-88-0
CAS NO.：24313-88-0
Empirical Formula: C9H13NO3
Molecular Weight: 183.2
MDL number: MFCD00008393
EINECS: 246-154-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB243.20 | In Stock |
|
| 100G | RMB849.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 110-113 °C (lit.) |
| Boiling point: | 316.88°C (rough estimate) |
| Density | 1.1967 (rough estimate) |
| refractive index | 1.4760 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 4.35±0.10(Predicted) |
| form | Powder |
| color | Off-white to beige-brown, gray, or pink |
| BRN | 642919 |
| InChI | InChI=1S/C9H13NO3/c1-11-7-4-6(10)5-8(12-2)9(7)13-3/h4-5H,10H2,1-3H3 |
| InChIKey | XEFRNCLPPFDWAC-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(OC)=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 24313-88-0(CAS DataBase Reference) |
| EPA Substance Registry System | 3,4,5-Trimethoxyaniline (24313-88-0) |
Description and Uses
3,4,5-Trimethoxyaniline is a tri-substituted aniline derivative with sympatholytic activity. It is used in the preparation of a novel class of anticancer agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340+P312 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 37/38-36/37/38-20/21/22 |
| Safety Statements | 22-24/25-37/39-26-24-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29222900 |
