A7698458
Hexetidine,mixtureofstereoisomers , 10mMinDMSO , 141-94-6
Synonym(s):
5-Amino-1,3-bis(2-ethylhexyl)hexahydro-5-methylpyrimidine;Hexetidine, mixture of stereoisomers;NSC 17764
CAS NO.:141-94-6
Empirical Formula: C21H45N3
Molecular Weight: 339.6
MDL number: MFCD00010428
EINECS: 205-513-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25°C |
| Boiling point: | 160 °C/0.4 mmHg (lit.) |
| Density | 0.889 g/mL at 25 °C (lit.) |
| refractive index | 1.4649 |
| Flash point: | 70°C |
| storage temp. | 2-8°C |
| solubility | acetone: soluble(lit.) |
| pka | 8.3(at 25℃) |
| form | Liquid |
| color | Clear Colourless |
| Water Solubility | Not miscible or difficult to mix in water. |
| Merck | 14,4703 |
| BRN | 161071 |
| Cosmetics Ingredients Functions | PRESERVATIVE ORAL CARE ANTIMICROBIAL |
| InChI | 1S/C21H45N3/c1-6-10-12-19(8-3)14-23-16-21(5,22)17-24(18-23)15-20(9-4)13-11-7-2/h19-20H,6-18,22H2,1-5H3 |
| InChIKey | DTOUUUZOYKYHEP-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)CN1CN(CC(CC)CCCC)CC(C)(N)C1 |
| LogP | 7.150 (est) |
| CAS DataBase Reference | 141-94-6(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Pyrimidinamine, 1,3-bis(2-ethylhexyl)hexahydro-5-methyl- (141-94-6) |
Description and Uses
Fungicide, bactericide, algicide, antistatic agent for synthetics, insect repellent, medicine (antifungal agent).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P280-P280-P304+P340+P312-P337+P313 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/38-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 2933599590 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 141-94-6(Hazardous Substances Data) |




