PRODUCT Properties
| Melting point: | 94-96 °C (lit.) |
| Boiling point: | 378.3±31.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| InChI | 1S/C14H14OS/c1-11-3-7-13(8-4-11)16(15)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | MJWNJEJCQHNDNM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(=O)c2ccc(C)cc2 |
| CAS DataBase Reference | 1774-35-2(CAS DataBase Reference) |
| NIST Chemistry Reference | P-tolyl sulfoxide(1774-35-2) |
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | XT4810000 |
| HS Code | 2930.90.2900 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,intraperitoneal,600mg/kg (600mg/kg),International Journal of Radiation Biology and Related Studies in Physics, Chemistry and Medicine. Vol. 3, Pg. 41, 1961. |
