A7700812
Tri-O-acetyl-D-glucal , 98% , 2873-29-2
Synonym(s):
1,2-Dideoxy-3,4,6-tri-O-acetyl-D -arabino-1-hexenopyranose;3,4,6-Tri-O-acetyl-1,5-anhydro-2-deoxy-D -arabino-hex-1-enitol
CAS NO.:2873-29-2
Empirical Formula: C12H16O7
Molecular Weight: 272.25
MDL number: MFCD00063253
EINECS: 220-709-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB32.00 | In Stock |
|
| 25G | RMB124.00 | In Stock |
|
| 100G | RMB476.00 | In Stock |
|
| 500g | RMB2059.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-55 °C(lit.) |
| Boiling point: | 335.31°C (rough estimate) |
| Density | 1.2602 (rough estimate) |
| refractive index | 1.4455 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | White to off-white |
| optical activity | [α]25/D 12°, c = 2 in ethanol |
| Water Solubility | Soluble in chloroform and ethanol. Insoluble in water. |
| BRN | 90781 |
| InChI | InChI=1/C12H16O7/c1-7(13)17-6-11-12(19-9(3)15)10(4-5-16-11)18-8(2)14/h4-5,10-12H,6H2,1-3H3/t10-,11-,12+/s3 |
| InChIKey | LLPWGHLVUPBSLP-FHMMHVPQNA-N |
| SMILES | [C@@H]1(OC(=O)C)[C@@H](COC(=O)C)OC=C[C@H]1OC(=O)C |&1:0,5,14,r| |
| CAS DataBase Reference | 2873-29-2(CAS DataBase Reference) |
Description and Uses
A D-glucal derivative.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317-H319 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29329995 |
| Storage Class | 11 - Combustible Solids |




