A7702112
1,3,5-Trimethyl-2,4,6-tris(3,5-di-tert-butyl -4-hydroxybenzyl)benzene , 99% , 1709-70-2
Synonym(s):
1,3,5-Trimethyl-2,4,6-tris(3,5-di-tert-butyl-4-hydroxybenzyl)benzene;2,4,6-Tris(3,5-di-tert -butyl-4-hydroxybenzyl)mesitylene;4,4′,4′′-[(2,4,6-Trimethyl-1,3,5-benzenetriyl)tris(methylene)]tris[2,6-bis(1,1-dimethylethyl)phenol
CAS NO.:1709-70-2
Empirical Formula: C54H78O3
Molecular Weight: 775.2
MDL number: MFCD00026284
EINECS: 216-971-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB26.40 | In Stock |
|
| 100G | RMB72.00 | In Stock |
|
| 500G | RMB224.00 | In Stock |
|
| 2.5kg | RMB972.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 248-250 °C(lit.) |
| Boiling point: | 739.54°C (rough estimate) |
| Density | 0.8883 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| Flash point: | 321℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Very Slightly, Heated, Sonicated) |
| pka | 11.91±0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 8.09μg/L at 20℃ |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| InChIKey | VSAWBBYYMBQKIK-UHFFFAOYSA-N |
| SMILES | Cc1c(Cc2cc(c(O)c(c2)C(C)(C)C)C(C)(C)C)c(C)c(Cc3cc(c(O)c(c3)C(C)(C)C)C(C)(C)C)c(C)c1Cc4cc(c(O)c(c4)C(C)(C)C)C(C)(C)C |
| LogP | 17.17 |
| CAS DataBase Reference | 1709-70-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3,5-Trimethyl-2,4,6-tris(3,5-di-tert-butyl-4-hydroxybenzyl)benzene (1709-70-2) |
Description and Uses
Antioxidant for polypropylene, high-density polyethylene, spandex fibers, polyamides, and specialty rubbers.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| RTECS | DC3750000 |
| TSCA | TSCA listed |
| HS Code | 2907299000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 oral in rat: 1500mg/kg |






