A7707358
L-Gulonicacidγ-lactone , 10mMinDMSO , 1128-23-0
Synonym(s):
L -Gulonic γ-lactone;L-(+)-Gulono-1,4-lactone
CAS NO.:1128-23-0
Empirical Formula: C6H10O6
Molecular Weight: 178.14
MDL number: MFCD00064331
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187-190 °C(lit.) |
| alpha | 54.5 º (c=2, water 57.5 ºC) |
| Boiling point: | 230.35°C (rough estimate) |
| Density | 1.3253 (rough estimate) |
| refractive index | 56 ° (C=2, H2O) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Sparingly) |
| form | Viscous Solution |
| pka | 12.06±0.60(Predicted) |
| color | White to Off-white |
| optical activity | [α]19/D +55°, c = 4 in H2O |
| Water Solubility | Soluble in water |
| BRN | 83002 |
| InChI | InChI=1/C6H10O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,7-10H,1H2/t2-,3+,4-,5+/s3 |
| InChIKey | SXZYCXMUPBBULW-QICJDPMJNA-N |
| SMILES | [C@H]1([C@@H](O)CO)OC(=O)[C@@H](O)[C@H]1O |&1:0,1,8,10,r| |
| CAS DataBase Reference | 1128-23-0(CAS DataBase Reference) |
Description and Uses
L-Gulono-1,4-lactone is a precursor in the biosynthesis of ascorbic acid, one of the many forms of Vitamin C.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29400090 |




