A7707558
                    Olmesartan , 10mMinDMSO , 144689-24-7
                            Synonym(s):
4-(1-Hydroxy-1-methylethyl)-2-propyl-1-[[2′-(2H-tetrazol-5-yl)[1,1′-biphenyl]-4-yl]methyl]-1H-imidazole-5-carboxylic acid;Olmesartan acid
                            
                        
                CAS NO.:144689-24-7
Empirical Formula: C24H26N6O3
Molecular Weight: 446.5
MDL number: MFCD00914967
EINECS: 646-413-5
| Pack Size | Price | Stock | Quantity | 
| 1ml | RMB159.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 186-188°C | 
                                    
| Boiling point: | 738.3±70.0 °C(Predicted) | 
                                    
| Density | 1.33 | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) | 
                                    
| pka | 2.39±0.50(Predicted) | 
                                    
| form | powder | 
                                    
| color | white to beige | 
                                    
| Stability: | Hygroscopic | 
                                    
| InChIKey | VTRAEEWXHOVJFV-UHFFFAOYSA-N | 
                                    
| SMILES | C1(CCC)N(CC2=CC=C(C3=CC=CC=C3C3=NNN=N3)C=C2)C(C(O)=O)=C(C(O)(C)C)N=1 | 
                                    
| CAS DataBase Reference | 144689-24-7(CAS DataBase Reference) | 
                                    
Description and Uses
An labelled angiotensin II receptor antagonist. Used as an anti-hypertensive
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H312-H332 | 
| Precautionary statements | P280-P302+P352-P312-P322-P363-P501-P261-P271-P304+P340-P312-P264-P270-P301+P312-P330-P501 | 
| RTECS | NI4014100 | 
| HS Code | 29339900 | 
| Hazardous Substances Data | 144689-24-7(Hazardous Substances Data) | 







