A7711558
Glyceroltrienanthate , 10mMinDMSO , 620-67-7
Synonym(s):
Triheptanoin;Trioenanthin;Trioenanthoin;1,2,3-Trienanthoylglycerol;Dermofeel TC 7
CAS NO.：620-67-7
Empirical Formula: C24H44O6
Molecular Weight: 428.6
MDL number: MFCD00042910
EINECS: 210-647-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 200 °C(Press: 1 Torr) |
| Density | 0.966 g/mL at 20 °C(lit.) |
| refractive index | n |
| storage temp. | Store at -20°C, protect from light |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml |
| form | A liquid |
| color | Colorless to light yellow |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C24H44O6/c1-4-7-10-13-16-22(25)28-19-21(30-24(27)18-15-12-9-6-3)20-29-23(26)17-14-11-8-5-2/h21H,4-20H2,1-3H3 |
| InChIKey | PJHKBYALYHRYSK-UHFFFAOYSA-N |
| SMILES | C(OC(=O)CCCCCC)C(OC(=O)CCCCCC)COC(=O)CCCCCC |
| LogP | 8.86 at 22℃ |
| CAS DataBase Reference | 620-67-7 |
| EPA Substance Registry System | Heptanoic acid, 1,1',1''-(1,2,3-propanetriyl) ester (620-67-7) |
Description and Uses
triheptanoin is a triglyceride that acts as a surfactant and skinconditioning agent, it also helps increase product viscosity. often used in cleansers, face and neck products, moisturizers and lipsticks.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 38 |
| WGK Germany | 1 |
| RTECS | MB2660000 |
| Toxicity | LD50 intravenous in mouse: 320mg/kg |
