A7712712
2,4,6-Tribromo-3-hydroxybenzoic acid , 98% , 14348-40-4
Synonym(s):
3-Hydroxy-2,4,6-tribromobenzoic acid
CAS NO.：14348-40-4
Empirical Formula: C7H3Br3O3
Molecular Weight: 374.81
MDL number: MFCD00055557
EINECS: 619-514-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.80 | In Stock |
|
| 5G | RMB171.20 | In Stock |
|
| 25G | RMB565.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-148 °C (lit.) |
| Boiling point: | 121°C (rough estimate) |
| Density | 2.3705 (rough estimate) |
| refractive index | 1.5438 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystals |
| pka | 1.15±0.10(Predicted) |
| color | White |
| Water Solubility | insoluble |
| BRN | 2844497 |
| InChI | InChI=1S/C7H3Br3O3/c8-2-1-3(9)6(11)5(10)4(2)7(12)13/h1,11H,(H,12,13) |
| InChIKey | YDBHVMTTYXWHLI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(Br)C=C(Br)C(O)=C1Br |
| CAS DataBase Reference | 14348-40-4(CAS DataBase Reference) |
Description and Uses
TBHBA (2,4,6-Tribromo-3-hydroxybenzoic acid; 3-Hydroxy-2,4,6-tribromobenzoic acid) is produced by reacting with 4-aminoantipyrine (4-AA) or 3-methylbenzothiazole in the presence of hydrogen peroxide and peroxidase. Oxidative coupling reaction of methylone hydrazone (MBTH) to form highly stable dyes.
TBHBA (2,4,6-Tribromo-3-hydroxybenzoic acid) is produced by reacting with 4-aminoantipyrine (4-AA) or 3-methylbenzothiazole in the presence of hydrogen peroxide and peroxidase. Oxidative coupling reaction of methylone hydrazone (MBTH) to form highly stable dyes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-20/22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29182900 |
