A7712858
Pindolol , 10mMinDMSO , 13523-86-9
Synonym(s):
1-(1H-Indol-4-yloxy)-3-(isopropylamino)-2-propanol;1-(1H-Indol-4-yloxy)-3-[(1-methylethyl)amino]-2-propanol;Pindolol
CAS NO.:13523-86-9
Empirical Formula: C14H20N2O2
Molecular Weight: 248.32
MDL number: MFCD00010530
EINECS: 236-867-9
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB277.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-171 °C(lit.) |
| Boiling point: | 391.39°C (rough estimate) |
| Density | 1.0606 (rough estimate) |
| refractive index | 1.5110 (estimate) |
| storage temp. | 2-8°C |
| solubility | 0.1 M NaOH: 0.2 mg/mL |
| form | powder |
| pka | pKa 9.26 (Uncertain) |
| color | white to off-white |
| Water Solubility | 33mg/L(22.5 ºC) |
| Merck | 13,7525 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C14H20N2O2/c1-10(2)16-8-11(17)9-18-14-5-3-4-13-12(14)6-7-15-13/h3-7,10-11,15-17H,8-9H2,1-2H3 |
| InChIKey | JZQKKSLKJUAGIC-UHFFFAOYSA-N |
| SMILES | C(OC1=CC=CC2=C1C=CN2)C(O)CNC(C)C |
| CAS DataBase Reference | 13523-86-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Pindolol(13523-86-9) |
| EPA Substance Registry System | 2-Propanol, 1-(1H-indol-4-yloxy)-3-[(1-methylethyl)amino]- (13523-86-9) |
Description and Uses
Mixed β-adrenergic blocker and serotonin 5HT1A-receptor antagonist. Antihypertensive; antianginal; antiarrhythmic; antiglaucoma.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | UB6660000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933995300 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 13523-86-9(Hazardous Substances Data) |
| Toxicity | LD50 oral in rabbit: 650mg/kg |






