A7716412
Triethylsilyl trifluoromethanesulfonate , 98% , 79271-56-0
Synonym(s):
TES triflate;Trifluoromethanesulfonic acid triethylsilylester
CAS NO.:79271-56-0
Empirical Formula: C7H15F3O3SSi
Molecular Weight: 264.34
MDL number: MFCD00000407
EINECS: 279-124-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB48.80 | In Stock |
|
| 25G | RMB121.60 | In Stock |
|
| 100G | RMB430.40 | In Stock |
|
| 500g | RMB1759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85-86 °C/12 mmHg (lit.) |
| Density | 1.169 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 162 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Triethylsilyl Trifluoromethanesulfonate is readily sol hydrocarbons, dialkyl ethers, halogenated
solvents. CH2Cl2 is employed most commonly. Reactions in
1,2-dichloroethane proceed faster than those in CCl4 or Et2O.
Protic solvents and THF react with trialkylsilyl triflates and are
therefore not suitable. |
| form | Fuming Liquid |
| Specific Gravity | 1.169 |
| color | Clear colorless to light brown |
| Water Solubility | Miscible with dichloromethane, hydrocarbons, dialkyl ethers and halogenated solvents. Immiscible with water. |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 3590541 |
| Stability: | Moisture Sensitive and Hygroscopic, Moisture Sensitive And Hygroscopic |
| InChI | 1S/C7H15F3O3SSi/c1-4-15(5-2,6-3)13-14(11,12)7(8,9)10/h4-6H2,1-3H3 |
| InChIKey | STMPXDBGVJZCEX-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)OS(=O)(=O)C(F)(F)F |
| CAS DataBase Reference | 79271-56-0(CAS DataBase Reference) |
Description and Uses
Triethylsilyl trifluoromethanesulfonate acts as a silylating agent. It is also useful as a Lewis acid catalyst. Further, it reacts with 1-diazo-3,3-dimethyl-butan-2-one to prepare 1-diazo-3,3-dimethyl-1-(triethylsilyl)-2-butanone.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,F |
| Risk Statements | 34-14 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive/Flammable |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







