A7718712
Trimesic acid , 98% , 554-95-0
Synonym(s):
BTC;TMA;Trimesic acid;H3BTC;1,3,5-Benzenetricarboxylic acid
CAS NO.:554-95-0
Empirical Formula: C9H6O6
Molecular Weight: 210.14
MDL number: MFCD00002517
EINECS: 209-077-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB24.00 | In Stock |
|
| 50g | RMB46.40 | In Stock |
|
| 100G | RMB56.00 | In Stock |
|
| 250g | RMB127.20 | In Stock |
|
| 500G | RMB238.40 | In Stock |
|
| 2.5kg | RMB1071.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 309.65°C (rough estimate) |
| Density | 1.4844 (rough estimate) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.6000 (estimate) |
| Flash point: | 328°C |
| storage temp. | Store below +30°C. |
| solubility | 26.3g/l |
| form | Powder |
| pka | pK1: 2.12;pK2: 4.10;pK3: 5.18 (25°C) |
| color | white |
| Water Solubility | Soluble in water, ethanol and methanol. |
| BRN | 2053080 |
| Stability: | Stable, but may be light sensitive. |
| Cosmetics Ingredients Functions | PLASTICISER |
| InChI | 1S/C9H6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | QMKYBPDZANOJGF-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(cc(c1)C(O)=O)C(O)=O |
| LogP | 1.35 at 21.41℃ |
| CAS DataBase Reference | 554-95-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,5-Benzenetricarboxylic acid(554-95-0) |
| EPA Substance Registry System | 1,3,5-Benzenetricarboxylic acid (554-95-0) |
Description and Uses
Trimesinic Acid is used for multifunctional therapeutics. It shows inhibitory activity against Torpedo Californica acetylcholinesterase and prevented amyloid-β peptide aggregate formation.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| Autoignition Temperature | 590 °C |
| TSCA | TSCA listed |
| HS Code | 29173980 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orally in Rabbit: 16000 mg/kg |






