A7719212
2,4,6-Trimethoxybenzaldehyde , 98% , 830-79-5
CAS NO.:830-79-5
Empirical Formula: C10H12O4
Molecular Weight: 196.2
MDL number: MFCD00003313
EINECS: 212-598-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB72.80 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100G | RMB557.60 | In Stock |
|
| 250g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-120 °C (lit.) |
| Boiling point: | 293.08°C (rough estimate) |
| Density | 1.2166 (rough estimate) |
| refractive index | 1.5550 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | Beige |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 1956051 |
| InChI | InChI=1S/C10H12O4/c1-12-7-4-9(13-2)8(6-11)10(5-7)14-3/h4-6H,1-3H3 |
| InChIKey | CRBZVDLXAIFERF-UHFFFAOYSA-N |
| SMILES | C(=O)C1=C(OC)C=C(OC)C=C1OC |
| CAS DataBase Reference | 830-79-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4,6-Trimethoxybenzaldehyde(830-79-5) |
Description and Uses
2,4,6-Trimethoxybenzaldehyde was used in the preparation and characterization of three RNA-specific fluorescent probes and their use in live cell imaging. It was used as starting reagent for the regioselective synthesis of new (+/-)-8-alkyl-5,7-dihydroxy-4-(4-hydroxyphenyl)-3,4-dihydrocoumarins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 22-24/25-45-36/37/39-27-26 |
| WGK Germany | 3 |
| RTECS | CU8460200 |
| HS Code | 29124990 |
| Storage Class | 11 - Combustible Solids |







