PRODUCT Properties
| Boiling point: | 311.69°C (rough estimate) |
| Density | 1.3767 (rough estimate) |
| refractive index | 1.4240 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO:23.0(Max Conc. mg/mL);128.37(Max Conc. mM) Water:36.0(Max Conc. mg/mL);200.93(Max Conc. mM) |
| form | Solid |
| pka | pKa 8.04(H2O,t = 15.5,I=0.00,N2)(Approximate) |
| Melting point: | 88 °C |
| color | White to Off-White |
| optical activity | α form +100 → +72(HCl) β form +28 → +47.5 |
| Henry's Law Constant | 1.3×1010 mol/(m3Pa) at 25℃, HSDB (2015) |
| Cosmetics Ingredients Functions | ANTISTATIC HAIR CONDITIONING |
| Cosmetic Ingredient Review (CIR) | Glucosamine (3416-24-8) |
| InChI | InChI=1S/C6H13NO5/c7-3(1-8)5(11)6(12)4(10)2-9/h1,3-6,9-12H,2,7H2/t3-,4+,5+,6+/m0/s1 |
| InChIKey | FZHXIRIBWMQPQF-SLPGGIOYSA-N |
| SMILES | O=C[C@H](N)[C@H]([C@@H]([C@@H](CO)O)O)O |
| LogP | -2.175 (est) |
| CAS DataBase Reference | 3416-24-8(CAS DataBase Reference) |
| EPA Substance Registry System | Glucosamine (3416-24-8) |
Description and Uses
Pharmaceutic aid.
Safety
| TSCA | TSCA listed |
| Hazardous Substances Data | 3416-24-8(Hazardous Substances Data) |



