A7722712
Tricyclazol , Analysis standard product, 99.0% , 41814-78-2
CAS NO.:41814-78-2
Empirical Formula: C9H7N3S
Molecular Weight: 189.24
MDL number: MFCD00072466
EINECS: 255-559-5
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB286.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187-188°C |
| Boiling point: | 275 °C |
| Density | 1.2292 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Very Slightly), Methanol |
| form | Solid |
| pka | 2.40±0.40(Predicted) |
| color | Light yellow to yellow |
| biological source | rabbit |
| Water Solubility | 1.6g/L(25 ºC) |
| BRN | 980261 |
| InChI | InChI=1S/C9H7N3S/c1-6-3-2-4-7-8(6)12-5-10-11-9(12)13-7/h2-5H,1H3 |
| InChIKey | DQJCHOQLCLEDLL-UHFFFAOYSA-N |
| SMILES | S1C2=CC=CC(C)=C2N2C=NN=C12 |
| LogP | 1.700 |
| CAS DataBase Reference | 41814-78-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Tricyclazole(41814-78-2) |
| EPA Substance Registry System | Tricyclazole (41814-78-2) |
Description and Uses
log Kow: 1.4. Solubility: In water at 25 ?C, 1.6 g/L. In acetone 10.4, methanol 25, xylene 2.1 (all in g/l, 25 ?C). Stability: Stable at 52 ?C. Relatively stable to ultraviolet light.
Tricyclazole is an common active ingredient in several commercial fungicide products used to control rice blast fungus, in transplanted and direct-seeded rice.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H412 |
| Precautionary statements | P264-P270-P273-P301+P310-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | 2588 |
| WGK Germany | 1 |
| RTECS | XZ5475000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29349990 |



