A7722858
L-Threonicacidhemicalciumsalt , 10mMinWater , 70753-61-6
Synonym(s):
(2R,3S)-2,3,4-Trihydroxybutyric acid hemicalcium salt;L -Threonic acid calcium salt
CAS NO.:70753-61-6
Empirical Formula: C8H14CaO10
Molecular Weight: 310.27
MDL number: MFCD00150824
EINECS: 615-158-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| alpha | 16 º (c=1, H2O) |
| refractive index | 15 ° (C=1, H2O) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Water (Slightly, Heated) |
| form | Powder |
| color | Pale Brown |
| optical activity | [α]20/D +16°, c = 1 in H2O |
| Water Solubility | Soluble in water. Sparingly soluble in methanol. |
| BRN | 5166008 |
| InChI | InChI=1/2C4H8O5.Ca.H2O/c2*5-1-2(6)3(7)4(8)9;;/h2*2-3,5-7H,1H2,(H,8,9);;1H2/q;;+2;/p-2/t2*2-,3+;;/s3 |
| InChIKey | ZJXGOFZGZFVRHK-BALCVSAKSA-L |
| SMILES | [C@@H](O)([C@@H](O)CO)C(=O)O[Ca]OC(=O)[C@H](O)[C@@H](O)CO.O |&1:0,2,13,15,r| |
| CAS DataBase Reference | 70753-61-6(CAS DataBase Reference) |
Description and Uses
L-Threonic acid calcium salt is the salt of L-Threonic acid, a naturally occurring compound that can be found in the leaves of Pelargonium crispum. L-Threonic acid is also the degradation product of Dehydroascorbate (DHA), a metabolite of Vitamin C (A786990).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| HS Code | 2918195000 |




