A7723212
o-Tolylacetic acid , 98% , 644-36-0
Synonym(s):
2-Methylphenylacetic acid
CAS NO.：644-36-0
Empirical Formula: C9H10O2
Molecular Weight: 150.17
MDL number: MFCD00004328
EINECS: 211-416-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB29.60 | In Stock |
|
| 100G | RMB59.20 | In Stock |
|
| 500G | RMB219.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-90 °C (lit.) |
| Boiling point: | 211.72°C (rough estimate) |
| Density | 0.9820 (rough estimate) |
| refractive index | 1.5470 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | pK1:4.36 (18°C) |
| form | Crystalline Powder |
| color | White to slightly cream |
| Water Solubility | insoluble |
| BRN | 1936952 |
| InChI | InChI=1S/C9H10O2/c1-7-4-2-3-5-8(7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | RZWGTXHSYZGXKF-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC=C1C |
| CAS DataBase Reference | 644-36-0(CAS DataBase Reference) |
| NIST Chemistry Reference | O-tolylacetic acid(644-36-0) |
Description and Uses
2-Methylphenylacetic acid is a ring-substituted phenylacetic acid with auxin activity used as a plant growth regulator.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
