PRODUCT Properties
| Melting point: | 158-161 °C (lit.) |
| Boiling point: | 215.33°C (rough estimate) |
| Density | 1.4769 (rough estimate) |
| refractive index | 1.4170 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 2.86±0.25(Predicted) |
| form | Solid |
| color | White to off-white |
| Merck | 14,5701 |
| Stability: | Stable, but light sensitive. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C4H5NO3/c5-3(6)1-2-4(7)8/h1-2H,(H2,5,6)(H,7,8)/b2-1- |
| InChIKey | FSQQTNAZHBEJLS-UPHRSURJSA-N |
| SMILES | C(O)(=O)/C=C\C(N)=O |
| CAS DataBase Reference | 557-24-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Maleamic acid(557-24-4) |
Description and Uses
Intermediate in the preparation of a new conjugated agent for radioiodination of proteins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2914.40.9000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




