A7723712
Acetobromo-α-D-glucose , 98%, including 2%CACO3 stabilizer , 572-09-8
Synonym(s):
1-Bromo-α-D -glucose tetraacetate;2,3,4,6-Tetra-O-acetyl-α-D -glucopyranosyl bromide
CAS NO.:572-09-8
Empirical Formula: C14H19BrO9
Molecular Weight: 411.2
MDL number: MFCD00063254
EINECS: 209-339-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5G | RMB82.40 | In Stock |
|
| 25G | RMB272.80 | In Stock |
|
| 50g | RMB511.20 | In Stock |
|
| 100G | RMB964.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-89 °C |
| Boiling point: | 0.125-30 °C(Press: 0.0005 Torr) |
| alpha | 194.5 º (c=2,chloroform) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | Acetontrile (Very Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Powder |
| color | White to beige |
| biological source | synthetic (organic) |
| optical activity | [α]25/D 188 to 202 °, c =1 in chloroform |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| Merck | 14,60 |
| BRN | 96669 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C14H19BrO9/c1-6(16)20-5-10-11(21-7(2)17)12(22-8(3)18)13(14(15)24-10)23-9(4)19/h10-14H,5H2,1-4H3/t10-,11-,12+,13-,14+/m1/s1 |
| InChIKey | CYAYKKUWALRRPA-RGDJUOJXSA-N |
| SMILES | CC(=O)OC[C@H]1O[C@H](Br)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| CAS DataBase Reference | 572-09-8(CAS DataBase Reference) |
Description and Uses
An Intermediate in synthesis of ∫-glucosides
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | - |
| F | 8-10-21 |
| HS Code | 29329985 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






