A7731912
Tributyl 2-acetylcitrate , 97% , 77-90-7
Synonym(s):
2-(Acetyloxy)-1,2,3-Propanetricarboxylic acid tributyl ester;Acetyl tributyl citrate;Tributyl 2-acetylcitrate;Tributylacetyl citrate
CAS NO.:77-90-7
Empirical Formula: C20H34O8
Molecular Weight: 402.48
MDL number: MFCD00043554
EINECS: 201-067-0
| Pack Size | Price | Stock | Quantity |
| 25ml | RMB23.20 | In Stock |
|
| 100ML | RMB47.20 | In Stock |
|
| 500ML | RMB172.00 | In Stock |
|
| 2.5L | RMB692.80 | In Stock |
|
| 10L | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -59 °C |
| Boiling point: | 327 °C |
| Density | 1.05 g/mL at 25 °C (lit.) |
| Pour Point | -43 |
| vapor pressure | 0.26 psi ( 20 °C) |
| refractive index | n |
| FEMA | 3080 | TRIBUTYL ACETYLCITRATE |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | Not miscible with water, miscible with ethanol (96 per cent) and with methylene chloride. |
| form | Liquid |
| color | Clear Colourless |
| Odor | at 100.00 %. very faint herbal wine sweet |
| Odor Type | herbal |
| biological source | synthetic |
| Water Solubility | <0.1 g/100 mL |
| FreezingPoint | -80℃ |
| JECFA Number | 630 |
| BRN | 2303316 |
| Cosmetics Ingredients Functions | FRAGRANCE PERFUMING PLASTICISER |
| Cosmetic Ingredient Review (CIR) | Acetyl tributyl citrate (77-90-7) |
| InChI | 1S/C20H34O8/c1-5-8-11-25-17(22)14-20(28-16(4)21,19(24)27-13-10-7-3)15-18(23)26-12-9-6-2/h5-15H2,1-4H3 |
| InChIKey | QZCLKYGREBVARF-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CC(CC(=O)OCCCC)(OC(C)=O)C(=O)OCCCC |
| LogP | 5.227 (est) |
| CAS DataBase Reference | 77-90-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2,3-Propanetricarboxylic acid, 2-(acetyloxy)-, tributyl ester(77-90-7) |
| EPA Substance Registry System | Acetyl tributyl citrate (77-90-7) |
Description and Uses
plasticizer flavoring agent
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | TZ8330000 |
| TSCA | TSCA listed |
| HS Code | 29181500 |
| Storage Class | 10 - Combustible liquids |
| Hazardous Substances Data | 77-90-7(Hazardous Substances Data) |




