A7733312
Thiamphenicol , Analysis standard product, 99% , 15318-45-3
Synonym(s):
D -threo-2,2-Dichloro-N-(β-hydroxy-α-[hydroxymethyl]-4-[methylsulfonyl]phenethyl)acetamide
CAS NO.:15318-45-3
Empirical Formula: C12H15Cl2NO5S
Molecular Weight: 356.22
MDL number: MFCD00467983
EINECS: 239-355-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB327.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-166 °C |
| alpha | D25 +12.9° (ethanol) |
| Density | 1.3281 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: 50 mg/mL, clear, colorless |
| Boiling point: | 695.9±55.0 °C(Predicted) |
| pka | 11.05±0.46(Predicted) |
| form | powder |
| color | white to off-white |
| Water Solubility | Soluble in acetonitrile or DMF. Slightly soluble in water |
| Merck | 14,9301 |
| BRN | 2819542 |
| Major Application | clinical |
| InChI | 1S/C12H15Cl2NO5S/c1-21(19,20)8-4-2-7(3-5-8)10(17)9(6-16)15-12(18)11(13)14/h2-5,9-11,16-17H,6H2,1H3,(H,15,18)/t9-,10-/m1/s1 |
| InChIKey | OTVAEFIXJLOWRX-NXEZZACHSA-N |
| SMILES | CS(=O)(=O)c1ccc(cc1)[C@@H](O)[C@@H](CO)NC(=O)C(Cl)Cl |
| CAS DataBase Reference | 15318-45-3 |
| EPA Substance Registry System | Thiamphenicol (15318-45-3) |
Description and Uses
chelating agent, antiseborrheic
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | AB6680000 |
| HS Code | 29414000 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | human,TDLo,unreported,214mg/kg/10D (214mg/kg),BEHAVIORAL: SLEEPGASTROINTESTINAL: NAUSEA OR VOMITINGSKIN AND APPENDAGES (SKIN): "DERMATITIS, OTHER: AFTER SYSTEMIC EXPOSURE",Arzneimittel-Forschung. Drug Research. Vol. 24, Pg. 944, 1974. |




