A7735912
L-(+)-Tartaric acid , ACS,≥99.5% , 87-69-4
Synonym(s):
(2R,3R)-(+)-Tartaric acid;(2R,3R)-(+)-Tartaric acid;L -Threaric acid;2,3-Dihydroxybutanedioic acid;L(+)-Tartaric acid
CAS NO.:87-69-4
Empirical Formula: C4H6O6
Molecular Weight: 150.09
MDL number: MFCD00064207
EINECS: 201-766-0
| Pack Size | Price | Stock | Quantity |
| 25g | RMB39.20 | In Stock |
|
| 100G | RMB71.20 | In Stock |
|
| 500G | RMB175.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-172 °C(lit.) |
| alpha | 12 º (c=20, H2O) |
| Boiling point: | 191.59°C (rough estimate) |
| Density | 1.76 |
| bulk density | 1000kg/m3 |
| vapor density | 5.18 (vs air) |
| vapor pressure | <5 Pa (20 °C) |
| FEMA | 3044 | TARTARIC ACID (D-, L-, DL-, MESO-) |
| refractive index | 12.5 ° (C=5, H2O) |
| Flash point: | 210 °C |
| storage temp. | Store at +5°C to +30°C. |
| solubility | H2O: soluble1M at 20°C, clear, colorless |
| form | Solid |
| pka | 2.98, 4.34(at 25℃) |
| color | White or colorless |
| PH | 3.18(1 mM solution);2.55(10 mM solution);2.01(100 mM solution); |
| Odor | at 100.00 %. odorless |
| Odor Type | odorless |
| biological source | Vitis vinifera |
| optical activity | [α]20/D +13.5±0.5°, c = 10% in H2O |
| Water Solubility | 1390 g/L (20 ºC) |
| Merck | 14,9070 |
| JECFA Number | 621 |
| BRN | 1725147 |
| Dielectric constant | 35.9(-10℃) |
| Stability: | Stable. Incompatible with oxidizing agents, bases, reducing agents. Combustible. |
| Cosmetics Ingredients Functions | FRAGRANCE BUFFERING |
| InChI | 1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2-/m1/s1 |
| InChIKey | FEWJPZIEWOKRBE-JCYAYHJZSA-N |
| SMILES | O[C@H]([C@@H](O)C(O)=O)C(O)=O |
| LogP | -1.43 |
| CAS DataBase Reference | 87-69-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanedioic acid, 2,3-dihydroxy- [r-(r*,r*)]-(87-69-4) |
| EPA Substance Registry System | Tartaric acid (87-69-4) |
Description and Uses
In the soft drink industry, confectionery products, bakery products, gelatin desserts, as an acidulant. In photography, tanning, ceramics, manufacture of tartrates. The common commercial esters are the diethyl and dibutyl derivatives used for lacquers and in textile printing. Pharmaceutic aid (buffering agent).
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36-37/39-36/37/39 |
| WGK Germany | 3 |
| RTECS | WW7875000 |
| Autoignition Temperature | 797 °F |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29181200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 |



