PRODUCT Properties
| Density | 1.24 |
| storage temp. | Store at -20°C |
| solubility | Soluble in methan |
| form | powder |
| color | White |
| Major Application | food and beverages |
| InChIKey | CYJWWQALTIKOAG-KNOFDGTPNA-N |
| SMILES | OC1C(C2C(C3C(C4(CCC5(C(CC(CC5)(C)C(=O)OC)C4=CC3)C(=O)O)C)(CC2)C)(CC1O)C)(CO)C |
Description and Uses
Phytolaccagenin (CAS# 1802-12-6) is a saponin found in Phytolacca acinosa and Phytolacca americana species which have antiproliferative activities in humans.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
