A7739012
1-(2,4,6-Triisopropylbenzenesulfonyl)imidazole , 98% , 50257-40-4
CAS NO.：50257-40-4
Empirical Formula: C18H26N2O2S
Molecular Weight: 334.48
MDL number: MFCD00005283
EINECS: 256-509-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB45.60 | In Stock |
|
| 5G | RMB134.40 | In Stock |
|
| 10g | RMB280.00 | In Stock |
|
| 25G | RMB476.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-120 °C(lit.) |
| Boiling point: | 449.7±55.0 °C(Predicted) |
| Density | 1.13±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 0.65±0.10(Predicted) |
| color | White to Almost white |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C18H26N2O2S/c1-12(2)15-9-16(13(3)4)18(17(10-15)14(5)6)23(21,22)20-8-7-19-11-20/h7-14H,1-6H3 |
| InChIKey | AGGRGODMKWLSDE-UHFFFAOYSA-N |
| SMILES | C1N(S(C2=C(C(C)C)C=C(C(C)C)C=C2C(C)C)(=O)=O)C=CN=1 |
| CAS DataBase Reference | 50257-40-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-(2,4,6-Trisopropylbenzenesulfonyl)imidazole(50257-40-4) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HS Code | 2933.29.4300 |
