A7739612
Tris(2,2′-bipyridine)dichlororuthenium(II) hexahydrate , 98% , 50525-27-4
Synonym(s):
Ru(BPY)3;Ruthenium-tris(2,2′-bipyridyl) dichloride;Tris(2,2′-bipyridyl)ruthenium(II) chloride hexahydrate
CAS NO.：50525-27-4
Empirical Formula: C30H26ClN6ORu+
Molecular Weight: 623.1
MDL number: MFCD00149670
EINECS: 238-266-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB45.60 | In Stock |
|
| 1G | RMB117.60 | In Stock |
|
| 5G | RMB517.60 | In Stock |
|
| 25G | RMB2135.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder |
| color | Red-orange to red |
| Water Solubility | Soluble in water. |
| Stability: | Stable, but may discolour upon exposure to light. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/3C10H8N2.ClH.H2O.Ru/c3*1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;/h3*1-8H;1H;1H2;/q;;;;;+2/p-1 |
| InChIKey | VCIOOYXESNFDKX-UHFFFAOYSA-M |
| SMILES | [Ru+2]123(N4=CC=CC=C4C4=CC=CC=N14)(N1=CC=CC=C1C1=CC=CC=N21)N1=CC=CC=C1C1=CC=CC=N31.[Cl-].O |
| CAS DataBase Reference | 50525-27-4(CAS DataBase Reference) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/38 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | VM2730000 |
| F | 8-10 |
| TSCA | Yes |
| HS Code | 28439000 |
| Storage Class | 11 - Combustible Solids |
