A7739658
                    Ethyl4-Methoxycinnamate , 10mMinDMSO , 24393-56-4
                            Synonym(s):
(E)-3-(4-Methoxyphenyl)-2-propenoic acid ethyl ester;trans-4-Methoxycinnamic acid ethyl ester;Ethyl (E)-3-(4-methoxyphenyl)-2-propenoate;Ethyl trans-4-methoxycinnamate
                            
                        
                CAS NO.:24393-56-4
Empirical Formula: C12H14O3
Molecular Weight: 206.24
MDL number: MFCD00026906
EINECS: 202-494-5
| Pack Size | Price | Stock | Quantity | 
| 1ml | RMB399.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 49°C | 
                                    
| Boiling point: | 187 °C / 15mmHg | 
                                    
| Density | 1.080±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| solubility | Chloroform (Slightly), Methanol (Slightly) | 
                                    
| form | Solid | 
                                    
| color | Off-White | 
                                    
| Water Solubility | insoluble in water | 
                                    
| BRN | 2210033 | 
                                    
| InChI | InChI=1S/C12H14O3/c1-3-15-12(13)9-6-10-4-7-11(14-2)8-5-10/h4-9H,3H2,1-2H3/b9-6+ | 
                                    
| InChIKey | DHNGCHLFKUPGPX-RMKNXTFCSA-N | 
                                    
| SMILES | C(OCC)(=O)/C=C/C1=CC=C(OC)C=C1 | 
                                    
| LogP | 2.650 (est) | 
                                    
| NIST Chemistry Reference | Ethyl p-methoxycinnamate(24393-56-4) | 
                                    
Description and Uses
Ethyl 4-methoxycinnamate is an derivative of 4-methoxycinnamic acid, an antihyperglycemic/hypoglycemic agent that works by stimulating insulin secretion from pancreas and could be developed into a new potential for therapeutic agent used in type 2 diabetic patients.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302 | 
| Precautionary statements | P264-P270-P301+P312-P501 | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36/37/39-24/25 | 
| WGK Germany | 3 | 
| HS Code | 29189900 | 



