A7740812
Tri(2-furyl)phosphine , 99% , 5518-52-5
Synonym(s):
TFP;Tri-2-furanylphosphine;Tris(2-furanyl)phosphine;Tris(o-furyl)phosphine
CAS NO.:5518-52-5
Empirical Formula: C12H9O3P
Molecular Weight: 232.17
MDL number: MFCD00151857
EINECS: 628-036-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB85.60 | In Stock |
|
| 5G | RMB216.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59-64 °C (lit.) |
| Boiling point: | 136 °C/4 mmHg (lit.) |
| Flash point: | 136°C/4mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | solid |
| color | faintly brown |
| Sensitive | air sensitive |
| BRN | 1577564 |
| InChI | InChI=1S/C12H9O3P/c1-4-10(13-7-1)16(11-5-2-8-14-11)12-6-3-9-15-12/h1-9H |
| InChIKey | DLQYXUGCCKQSRJ-UHFFFAOYSA-N |
| SMILES | P(C1=CC=CO1)(C1=CC=CO1)C1=CC=CO1 |
| CAS DataBase Reference | 5518-52-5(CAS DataBase Reference) |
Description and Uses
TRI(2-FURYL)PHOSPHINE is a phopshine ligand used in transition-metal mediated organic synthesis, in particular in wittig reactions to improved (Z) selectivity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | No |
| HS Code | 29319090 |






