A7743712
m-Terphenyl , Analysis of standard products, for environmental analysis, ≥99.5%(GC) , 92-06-8
Synonym(s):
1,3-Diphenylbenzene
CAS NO.：92-06-8
Empirical Formula: C18H14
Molecular Weight: 230.3
MDL number: MFCD00003059
EINECS: 202-122-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB319.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 84-88 °C (lit.) |
| Boiling point: | 379 °C (lit.) |
| Density | 1,2 g/cm3 |
| refractive index | 1.5681 (estimate) |
| Flash point: | 191°C |
| storage temp. | Store at room temperature |
| color | White to Light yellow |
| Water Solubility | 1.511mg/L(25 ºC) |
| BRN | 1864778 |
| Exposure limits | NIOSH: IDLH 500 mg/m3; Ceiling 0.5 ppm(5 mg/m3) |
| InChI | InChI=1S/C18H14/c1-3-8-15(9-4-1)17-12-7-13-18(14-17)16-10-5-2-6-11-16/h1-14H |
| InChIKey | YJTKZCDBKVTVBY-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC(C3=CC=CC=C3)=C2)=CC=CC=C1 |
| CAS DataBase Reference | 92-06-8(CAS DataBase Reference) |
| NIST Chemistry Reference | m-Terphenyl(92-06-8) |
| EPA Substance Registry System | m-Terphenyl (92-06-8) |
Description and Uses
m-Terphenyl is a polychlorinated terphenyl used in electronic equipments, lubricants, sealants and other devices. It is also found as a global environmental contaminant.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H400 |
| Precautionary statements | P273-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-50/53-50 |
| Safety Statements | 26-36-61-60 |
| RIDADR | UN 3077 9/PG 3 |
| OEL | Ceiling: 5 mg/m3 (0.5 ppm) |
| WGK Germany | 2 |
| RTECS | WZ6470000 |
| TSCA | Yes |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29029090 |
| Hazardous Substances Data | 92-06-8(Hazardous Substances Data) |
