A7746712
3-(Trifluoromethyl)phenylboronic acid（contains varying amounts of Anhydride） , 97% , 1423-26-3
Synonym(s):
3-(Trifluoromethyl)benzeneboronic acid;a,a,a-Trifluoro-m-tolueneboronic acid
CAS NO.：1423-26-3
Empirical Formula: C7H6BF3O2
Molecular Weight: 189.93
MDL number: MFCD00151854
EINECS: 604-284-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB51.20 | In Stock |
|
| 25G | RMB188.00 | In Stock |
|
| 100G | RMB736.00 | In Stock |
|
| 500g | RMB3119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-166 °C (lit.) |
| Boiling point: | 268.2±50.0 °C(Predicted) |
| Density | 1.36±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | slightly sol. in Methanol |
| pka | 7.55±0.10(Predicted) |
| form | Powder |
| color | White to pale yellow |
| BRN | 6084746 |
| InChI | InChI=1S/C7H6BF3O2/c9-7(10,11)5-2-1-3-6(4-5)8(12)13/h1-4,12-13H |
| InChIKey | WOAORAPRPVIATR-UHFFFAOYSA-N |
| SMILES | C1(B(O)O)=CC=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 1423-26-3(CAS DataBase Reference) |
Description and Uses
Reactant involved in:
- Suzuki-Miyaura cross-coupling reactions
- Aerobic oxidative cross-coupling
- Microwave-assisted Petasis reactions
- Rhodium-catalyzed addition reactions
- Syntehsis of biologically active molecules
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
