A7747558
L-Leucyl-L-alanineHydrate , 10mMinWater , 7298-84-2
Synonym(s):
L -Leucyl-L -alanine hydrate
CAS NO.：7298-84-2
Empirical Formula: C9H18N2O3
Molecular Weight: 202.25
MDL number: MFCD00002641
EINECS: 230-737-5
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 255-256 °C (decomp) |
| Boiling point: | 409.7±30.0 °C(Predicted) |
| Density | 1.108±0.06 g/cm3(Predicted) |
| refractive index | 19 ° (C=5, MeOH) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Water:100.0(Max Conc. mg/mL);494.43(Max Conc. mM) |
| pka | 3.16±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 1726165 |
| InChI | InChI=1S/C9H18N2O3/c1-5(2)4-7(10)8(12)11-6(3)9(13)14/h5-7H,4,10H2,1-3H3,(H,11,12)(H,13,14)/t6-,7-/m0/s1 |
| InChIKey | HSQGMTRYSIHDAC-BQBZGAKWSA-N |
| SMILES | C(O)(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N |
| CAS DataBase Reference | 7298-84-2(CAS DataBase Reference) |
| EPA Substance Registry System | L-Alanine, L-leucyl- (7298-84-2) |
Description and Uses
ubiquitin blocker, neurite growth inhibitor
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| WGK Germany | 3 |
| F | 3-10 |
