A7749412
Tris-(8-hydroxyquinoline)aluminum , 99.995% , 2085-33-8
Synonym(s):
8-Hydroxyquinoline aluminum salt;Alq3;Aluminum 8-hydroxyquinolinate;Aluminum oxinate;Tris-(8-hydroxyquinolinato)aluminum
CAS NO.:2085-33-8
Empirical Formula: C27H18AlN3O3
Molecular Weight: 459.43
MDL number: MFCD00191693
EINECS: 218-227-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB431.20 | In Stock |
|
| 5G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 21 °C(Press: 0.16 Torr) |
| Density | 1.19 g/cm3 |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| solubility | Solubility in chloroform |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| λmax | 259 nm |
| Merck | 14,370 |
| Exposure limits | ACGIH: TWA 1 mg/m3 |
| InChI | InChI=1S/3C9H7NO.Al/c3*11-8-5-1-3-7-4-2-6-10-9(7)8;/h3*1-6,11H;/q;;;+3/p-3 |
| InChIKey | TVIVIEFSHFOWTE-UHFFFAOYSA-K |
| SMILES | C12N=CC=CC=1C=CC=C2O[Al](OC1C=CC=C2C=CC=NC=12)OC1C=CC=C2C=CC=NC=12 |
| CAS DataBase Reference | 2085-33-8(CAS DataBase Reference) |
| Absorption | λmax 259 nm (in THF) |
Description and Uses
Tris(8-hydroxyquinoline)aluminum(III) is an OLEDs intermidate which has high thermal stability, high quantum yield of fluorescence and high electron-transport ability.
In OLEDs as an electron transport and/or light emitting layer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | BD2231000 |
| TSCA | No |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




