A7752012
Thiocyanic acid (2-benzothiazolylthio)methyl ester , Analysis standard , 21564-17-0
CAS NO.:21564-17-0
Empirical Formula: C9H6N2S3
Molecular Weight: 238.35
MDL number: MFCD00072503
EINECS: 244-445-0
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-10 °C |
| Boiling point: | >120 °C |
| Density | d25 1.05 (c = 0.30) |
| refractive index | 1.5500 (estimate) |
| Flash point: | (open cup): 66°C |
| storage temp. | 0-6°C |
| solubility | soluble in Chloroform, Ethyl Acetate |
| form | Oil |
| pka | -0.09±0.10(Predicted) |
| color | Brown to Dark Brown |
| Odor | pungent odor |
| InChI | InChI=1S/C9H6N2S3/c10-5-12-6-13-9-11-7-3-1-2-4-8(7)14-9/h1-4H,6H2 |
| InChIKey | TUBQDCKAWGHZPF-UHFFFAOYSA-N |
| SMILES | S(CSC1=NC2=CC=CC=C2S1)C#N |
| CAS DataBase Reference | 21564-17-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Thiocyanic acid, (2-benzothiazolylthio)methyl ester(21564-17-0) |
| EPA Substance Registry System | 2-(Benzothiazolylthio)methyl thiocyanate (21564-17-0) |
Description and Uses
2-(Thiocyanatomethylthio)benzothiazole is an antimicrobial agent used as a substitute for chlorophenols in industrial applications.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H319-H330-H410 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P302+P352-P321-P332+P313-P362-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P264-P280-P305+P351+P338-P337+P313P-P260-P271-P284-P304+P340-P310-P320-P403+P233-P405-P501-P273-P391-P501 |
| Hazard Codes | T+,N,Xn |
| Risk Statements | 22-26-36/38-43-50/53-36/37/38 |
| Safety Statements | 28-36/37-38-45-60-61-36-26 |
| RTECS | XK8150900 |
| HS Code | 29342000 |
| Hazardous Substances Data | 21564-17-0(Hazardous Substances Data) |
| Toxicity | LD50 in male, female rats (mg/kg): 752, 679 orally (Rush) |





