A7754412
Triphenylphosphine-3,3′,3′′-trisulfonic acid trisodium salt , 90% , 63995-70-0
Synonym(s):
3,3′,3″-Phosphinidynetris(benzenesulfonic acid) trisodium salt;Tris(3-sulfophenyl)phosphine trisodium salt
CAS NO.:63995-70-0
Empirical Formula: C18H12Na3O9PS3
Molecular Weight: 568.42
MDL number: MFCD00221694
EINECS: 264-596-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB70.40 | In Stock |
|
| 1G | RMB204.80 | In Stock |
|
| 5G | RMB774.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | Powder |
| color | white to off-white |
| Water Solubility | Soluble in water. |
| BRN | 3584807 |
| Stability: | Hygroscopic |
| InChIKey | CWBHBKSVWBUDKB-UHFFFAOYSA-N |
| SMILES | P(C1C=CC=C(S(O)(=O)=O)C=1)(C1C=CC=C(S(O)(=O)=O)C=1)C1C=CC=C(S(O)(=O)=O)C=1.[NaH] |
Description and Uses
Tris(3-sulfophenyl)phosphine Trisodium Salt (Triphenylphosphine-3,3',3''-trisulfonic acid trisodium salt) is a reagent used in organic synthesis such as benzothiazole-based cycloplatinated chromophores.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 1 |
| F | 10 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






