A7756912
5,10,15,20-Tetra(4-pyridyl)-21H,23H-porphine , 97% , 16834-13-2
Synonym(s):
5,10,15,20-Tetra(4-pyridyl)porphyrin
CAS NO.:16834-13-2
Empirical Formula: C40H26N8
Molecular Weight: 618.69
MDL number: MFCD00009626
EINECS: 240-858-5
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB63.20 | In Stock |
|
| 250MG | RMB165.60 | In Stock |
|
| 1G | RMB530.40 | In Stock |
|
| 5G | RMB2560.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.335±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| color | purple |
| λmax | 442 nm |
| BRN | 635257 |
| InChIKey | DNZSHSJERXNJGX-XXDGMDECSA-N |
| SMILES | C1(C2C=CN=CC=2)=C2N=C(C(C3C=CN=CC=3)=C3NC(=C(C4C=CN=CC=4)C4=NC(=C(C5C=CN=CC=5)C5NC1=CC=5)C=C4)C=C3)C=C2 |c:18,t:7,21,32| |
| EPA Substance Registry System | 21H,23H-Porphine, 5,10,15,20-tetra-4-pyridinyl- (16834-13-2) |
Description and Uses
5,10,15,20-(tetra-4-pyridyl)porphyrin is a pyridine substituted synthetic porphyrin. It can act as a sensitive amperometric sensor.
5,10,15,20-Tetra(4-pyridyl)-21H,23H-porphine is used in the making of coordination catalysts.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |



![Bis(ZincPorphyrin)(<i>ca</i>.5μmol/LinDichloromethane)[forCDSpectroscopy]](https://img.chemicalbook.com/CAS/20211123/GIF/92995-45-4.gif)

