PRODUCT Properties
| Melting point: | 141-142 °C |
| Boiling point: | 469.5±45.0 °C(Predicted) |
| Density | 1.320±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Soluble in acetonitrile and chloroform |
| form | powder |
| color | White |
| Major Application | food and beverages |
| InChI | InChI=1S/C16H14O5/c1-16(2)13(21-16)8-19-15-9-3-4-14(17)20-12(9)7-11-10(15)5-6-18-11/h3-7,13H,8H2,1-2H3 |
| InChIKey | QTAGQHZOLRFCBU-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC3OC=CC=3C(OCC3C(C)(C)O3)=C2C=C1 |
| LogP | 1.740 (est) |
Description and Uses
Oxypeucedanin is a derivative of Psoralen (P839800) which are phytoalexins; they are used by plants in a defensive response to attacks by fungi and insects. They have also shown photosensitizing and phototoxic effects in animals and humans and have been used in photochemotherapy for management of vitiligo, psoriasis, and mycosis fungoides. Used as photochemical probe in biological systems.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| WGK Germany | WGK 1 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
