A7759112
2,4,5-Trichloropyrimidine , 98% , 5750-76-5
CAS NO.:5750-76-5
Empirical Formula: C4HCl3N2
Molecular Weight: 183.42
MDL number: MFCD03788200
EINECS: 628-281-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB108.80 | In Stock |
|
| 100G | RMB378.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 84°C 1mm |
| Density | 1.6001 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | -4.26±0.29(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 4449 |
| InChI | InChI=1S/C4HCl3N2/c5-2-1-8-4(7)9-3(2)6/h1H |
| InChIKey | GIKMWFAAEIACRF-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(Cl)C(Cl)=N1 |
| CAS DataBase Reference | 5750-76-5(CAS DataBase Reference) |
Description and Uses
2,4,5-Trichloropyrimidine is used in the synthesis of potent and selective anaplastic lymphoma kinase (ALK-5) inhibitors, used as an anti-tumor treatment. Also used in the synthesis of EGFR inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3267 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



