PRODUCT Properties
| Melting point: | 204-205oC |
| Boiling point: | 436.2±40.0 °C(Predicted) |
| Density | 1.171±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Aqueous Acid (Sparingly, Sonicated), Aqueous Base (Sparingly), Water (Sparingly) |
| form | Solid |
| pka | 3.41±0.10(Predicted) |
| color | White to Off-White |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C7H14N2O3/c1-5(10)9-6(7(11)12)3-2-4-8/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | JRLGPAXAGHMNOL-LURJTMIESA-N |
| SMILES | CC(=O)N[C@@H](CCCN)C(O)=O |
Description and Uses
Nα-Acetyl-L-ornithine is used in the identification of type 2 diabetes group through topological analysis of patient similarity.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
