A7762412
Tectoridin , Analysis of standards,> 98% , 611-40-5
Synonym(s):
D -Glucopyranosyloxy)-5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one;Shekanin;Tectorigenin 7-O-β-D -glucopyranoside
| Pack Size | Price | Stock | Quantity |
| 20MG | RMB238.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 256-258° |
| alpha | D20 -29.4° (pyridine) |
| Boiling point: | 798.1±60.0 °C(Predicted) |
| Density | 1.609±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in methan |
| form | Solid |
| pka | 6.10±0.20(Predicted) |
| color | White to Almost white |
| InChIKey | CNOURESJATUGPN-NOKHNQDYNA-N |
| SMILES | C12OC=C(C3C=CC(O)=CC=3)C(=O)C=1C(O)=C(OC)C(O[C@H]1[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O)=C2 |&1:21,22,24,25,27,r| |
Description and Uses
Tectoridin is identified as a potent lactate dehydrogenase (LDH) inhibitor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| WGK Germany | 3 |
| RTECS | DJ3090000 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |




