A7764058
Maackiain , 10mMinDMSO , 19908-48-6
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 199-200 °C |
| Boiling point: | 436.2±45.0 °C(Predicted) |
| Density | 1.480±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 9.45±0.20(Predicted) |
| color | White to off-white |
| InChI | InChI=1/C16H12O5/c17-8-1-2-9-12(3-8)18-6-11-10-4-14-15(20-7-19-14)5-13(10)21-16(9)11/h1-5,11,16-17H,6-7H2/t11-,16-/s3 |
| InChIKey | HUKSJTUUSUGIDC-GLKDQJSUNA-N |
| SMILES | [C@@]12([H])OC3C=C4OCOC4=CC=3[C@]1([H])COC1C=C(O)C=CC2=1 |&1:0,12,r| |
Description and Uses
(±)-Maackiain can be used to improve collage synthesis of skin fibroblast to improve skin regeneration effects. It can also be used to inhibit expression of allergy-sensitive genes and fungicidal activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |





